C9H19NO6S — CID 79594626
2-hydroxy-2-methyl-3-(2-propan-2-yloxyethylsulfonylamino)propanoic acid (PubChem CID 79594626) has the molecular formula C9H19NO6S and a molecular weight of 269.32 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-3-(2-propan-2-yloxyethylsulfonylamino)propanoic acid.
| Compound Name | 2-hydroxy-2-methyl-3-(2-propan-2-yloxyethylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 79594626 |
| Molecular Formula | C9H19NO6S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 2-hydroxy-2-methyl-3-(2-propan-2-yloxyethylsulfonylamino)propanoic acid |
| SMILES | CC(C)OCCS(=O)(=O)NCC(C)(O)C(=O)O |
| InChI | InChI=1S/C9H19NO6S/c1-7(2)16-4-5-17(14,15)10-6-9(3,13)8(11)12/h7,10,13H,4-6H2,1-3H3,(H,11,12) |
| InChIKey | VFLRFLNZPSFESH-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |