C13H20O7 — CID 174692194
methyl 2-hydroxyprop-2-enoate;methyl 2-methylprop-2-enoate;methyl prop-2-enoate (PubChem CID 174692194) has the molecular formula C13H20O7 and a molecular weight of 288.30 g/mol. Its IUPAC name is methyl 2-hydroxyprop-2-enoate;methyl 2-methylprop-2-enoate;methyl prop-2-enoate.
| Compound Name | methyl 2-hydroxyprop-2-enoate;methyl 2-methylprop-2-enoate;methyl prop-2-enoate |
|---|---|
| PubChem CID | 174692194 |
| Molecular Formula | C13H20O7 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | methyl 2-hydroxyprop-2-enoate;methyl 2-methylprop-2-enoate;methyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OC.C=C(O)C(=O)OC.C=CC(=O)OC |
| InChI | InChI=1S/C5H8O2.C4H6O3.C4H6O2/c1-4(2)5(6)7-3;1-3(5)4(6)7-2;1-3-4(5)6-2/h1H2,2-3H3;5H,1H2,2H3;3H,1H2,2H3 |
| InChIKey | GTHDIYAASUEBEK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|