C19H22O4 — CID 20987004
3-[4-[2-(2,3-dimethylphenoxy)ethoxy]phenyl]propanoic acid (PubChem CID 20987004) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is 3-[4-[2-(2,3-dimethylphenoxy)ethoxy]phenyl]propanoic acid.
| Compound Name | 3-[4-[2-(2,3-dimethylphenoxy)ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 20987004 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 3-[4-[2-(2,3-dimethylphenoxy)ethoxy]phenyl]propanoic acid |
| SMILES | Cc1cccc(OCCOc2ccc(CCC(=O)O)cc2)c1C |
| InChI | InChI=1S/C19H22O4/c1-14-4-3-5-18(15(14)2)23-13-12-22-17-9-6-16(7-10-17)8-11-19(20)21/h3-7,9-10H,8,11-13H2,1-2H3,(H,20,21) |
| InChIKey | RQWZXAFUWXDHFO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|