C14H22O5P2 — CID 172860673
[(2,4-ditert-butylphenoxy)-hydroxyphosphanyl]oxy-oxido-oxophosphanium (PubChem CID 172860673) has the molecular formula C14H22O5P2 and a molecular weight of 332.27 g/mol. Its IUPAC name is [(2,4-ditert-butylphenoxy)-hydroxyphosphanyl]oxy-oxido-oxophosphanium.
| Compound Name | [(2,4-ditert-butylphenoxy)-hydroxyphosphanyl]oxy-oxido-oxophosphanium |
|---|---|
| PubChem CID | 172860673 |
| Molecular Formula | C14H22O5P2 |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | [(2,4-ditert-butylphenoxy)-hydroxyphosphanyl]oxy-oxido-oxophosphanium |
| SMILES | CC(C)(C)c1ccc(OP(O)O[P+](=O)[O-])c(C(C)(C)C)c1 |
| InChI | InChI=1S/C14H22O5P2/c1-13(2,3)10-7-8-12(11(9-10)14(4,5)6)18-21(17)19-20(15)16/h7-9,17H,1-6H3 |
| InChIKey | ZHQDOAQVMQDHOA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 78.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|