About 2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene;dibutyltin
2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene;dibutyltin (PubChem CID 160778767) has the molecular formula C36H60OSn
and a molecular weight of 627.59 g/mol. Its IUPAC name is 2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene;dibutyltin.
Molecular Properties
| Compound Name | 2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene;dibutyltin |
| PubChem CID | 160778767 |
| Molecular Formula | C36H60OSn |
| Molecular Weight | 627.59 g/mol |
| Exact Mass | 628.37 |
| IUPAC Name | 2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene;dibutyltin |
| SMILES | CC(C)(C)c1ccc(Oc2ccc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1.CCCC[Sn]CCCC |
| InChI | InChI=1S/C28H42O.2C4H9.Sn/c1-25(2,3)19-13-15-23(21(17-19)27(7,8)9)29-24-16-14-20(26(4,5)6)18-22(24)28(10,11)12;2*1-3-4-2;/h13-18H,1-12H3;2*1,3-4H2,2H3; |
| InChIKey | SAHKMZZHANOPTA-UHFFFAOYSA-N |
| XLogP | 11.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 627.59 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene;dibutyltin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene;dibutyltin?
The IUPAC name of 2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene;dibutyltin (CID 160778767) is 2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene;dibutyltin.
What is the SMILES notation for 2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene;dibutyltin?
The canonical SMILES for 2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene;dibutyltin is CC(C)(C)c1ccc(Oc2ccc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1.CCCC[Sn]CCCC.
What is the InChIKey of 2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene;dibutyltin?
The InChIKey is SAHKMZZHANOPTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H42O.2C4H9.Sn/c1-25(2,3)19-13-15-23(21(17-19)27(7,8)9)29-24-16-14-20(26(4,5)6)18-22(24)28(10,11)12;2*1-3-4-2;/h13-18H,1-12H3;2*1,3-4H2,2H3;.
What are the key properties of 2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene;dibutyltin?
2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene;dibutyltin has a molecular weight of 627.59 g/mol, XLogP of 11.80, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-ditert-butyl-1-(2,4-ditert-butylphenoxy)benzene;dibutyltin is sourced from PubChem (CID 160778767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).