C18H21Cl2NO3 — CID 54801778
N-[2-(2,4-dichlorophenoxy)ethyl]-2-(2-ethoxyethoxy)aniline (PubChem CID 54801778) has the molecular formula C18H21Cl2NO3 and a molecular weight of 370.28 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenoxy)ethyl]-2-(2-ethoxyethoxy)aniline.
| Compound Name | N-[2-(2,4-dichlorophenoxy)ethyl]-2-(2-ethoxyethoxy)aniline |
|---|---|
| PubChem CID | 54801778 |
| Molecular Formula | C18H21Cl2NO3 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | N-[2-(2,4-dichlorophenoxy)ethyl]-2-(2-ethoxyethoxy)aniline |
| SMILES | CCOCCOc1ccccc1NCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H21Cl2NO3/c1-2-22-11-12-24-18-6-4-3-5-16(18)21-9-10-23-17-8-7-14(19)13-15(17)20/h3-8,13,21H,2,9-12H2,1H3 |
| InChIKey | JWLUIEWHUANIAT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|