C13H20NNaO4S — CID 23692010
sodium 6-(2-methoxyanilino)hexane-1-sulfonate (PubChem CID 23692010) has the molecular formula C13H20NNaO4S and a molecular weight of 309.36 g/mol. Its IUPAC name is sodium 6-(2-methoxyanilino)hexane-1-sulfonate.
| Compound Name | sodium 6-(2-methoxyanilino)hexane-1-sulfonate |
|---|---|
| PubChem CID | 23692010 |
| Molecular Formula | C13H20NNaO4S |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | sodium 6-(2-methoxyanilino)hexane-1-sulfonate |
| SMILES | COc1ccccc1NCCCCCCS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C13H21NO4S.Na/c1-18-13-9-5-4-8-12(13)14-10-6-2-3-7-11-19(15,16)17;/h4-5,8-9,14H,2-3,6-7,10-11H2,1H3,(H,15,16,17);/q;+1/p-1 |
| InChIKey | DWVWTAGGMVMWDL-UHFFFAOYSA-M |
| XLogP | -0.78 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|