C16H23NO8S — CID 158141355
2-(2-methoxyanilino)ethanol;2-methylbenzene-1,3-diol;sulfuric acid (PubChem CID 158141355) has the molecular formula C16H23NO8S and a molecular weight of 389.43 g/mol. Its IUPAC name is 2-(2-methoxyanilino)ethanol;2-methylbenzene-1,3-diol;sulfuric acid.
| Compound Name | 2-(2-methoxyanilino)ethanol;2-methylbenzene-1,3-diol;sulfuric acid |
|---|---|
| PubChem CID | 158141355 |
| Molecular Formula | C16H23NO8S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 2-(2-methoxyanilino)ethanol;2-methylbenzene-1,3-diol;sulfuric acid |
| SMILES | COc1ccccc1NCCO.Cc1c(O)cccc1O.O=S(=O)(O)O |
| InChI | InChI=1S/C9H13NO2.C7H8O2.H2O4S/c1-12-9-5-3-2-4-8(9)10-6-7-11;1-5-6(8)3-2-4-7(5)9;1-5(2,3)4/h2-5,10-11H,6-7H2,1H3;2-4,8-9H,1H3;(H2,1,2,3,4) |
| InChIKey | FTZCOACHQIEXGW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 156.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|