C15H18N2O4S — CID 70612965
3-(2-hydroxyethylamino)-4-methoxy-N-phenylbenzenesulfonamide (PubChem CID 70612965) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is 3-(2-hydroxyethylamino)-4-methoxy-N-phenylbenzenesulfonamide.
| Compound Name | 3-(2-hydroxyethylamino)-4-methoxy-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 70612965 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 3-(2-hydroxyethylamino)-4-methoxy-N-phenylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccccc2)cc1NCCO |
| InChI | InChI=1S/C15H18N2O4S/c1-21-15-8-7-13(11-14(15)16-9-10-18)22(19,20)17-12-5-3-2-4-6-12/h2-8,11,16-18H,9-10H2,1H3 |
| InChIKey | INEDVPNJKXZKCG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |