C16H24BrNOS — CID 115401860
5-(4-bromo-2-propan-2-ylphenoxy)-2,2-dimethylpentanethioamide (PubChem CID 115401860) has the molecular formula C16H24BrNOS and a molecular weight of 358.35 g/mol. Its IUPAC name is 5-(4-bromo-2-propan-2-ylphenoxy)-2,2-dimethylpentanethioamide.
| Compound Name | 5-(4-bromo-2-propan-2-ylphenoxy)-2,2-dimethylpentanethioamide |
|---|---|
| PubChem CID | 115401860 |
| Molecular Formula | C16H24BrNOS |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 5-(4-bromo-2-propan-2-ylphenoxy)-2,2-dimethylpentanethioamide |
| SMILES | CC(C)c1cc(Br)ccc1OCCCC(C)(C)C(N)=S |
| InChI | InChI=1S/C16H24BrNOS/c1-11(2)13-10-12(17)6-7-14(13)19-9-5-8-16(3,4)15(18)20/h6-7,10-11H,5,8-9H2,1-4H3,(H2,18,20) |
| InChIKey | WDTRZSPDVVRJQL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|