C15H23NO2S — CID 65257289
5-[3-(methoxymethyl)phenoxy]-2,2-dimethylpentanethioamide (PubChem CID 65257289) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is 5-[3-(methoxymethyl)phenoxy]-2,2-dimethylpentanethioamide.
| Compound Name | 5-[3-(methoxymethyl)phenoxy]-2,2-dimethylpentanethioamide |
|---|---|
| PubChem CID | 65257289 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 5-[3-(methoxymethyl)phenoxy]-2,2-dimethylpentanethioamide |
| SMILES | COCc1cccc(OCCCC(C)(C)C(N)=S)c1 |
| InChI | InChI=1S/C15H23NO2S/c1-15(2,14(16)19)8-5-9-18-13-7-4-6-12(10-13)11-17-3/h4,6-7,10H,5,8-9,11H2,1-3H3,(H2,16,19) |
| InChIKey | BURNVNBPNCWECM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|