C15H31NO6S — CID 138728417
N-[2-[2-[2-[2-(methylsulfanylmethoxy)ethoxy]ethoxy]ethoxy]ethyl]-2-propan-2-yloxyacetamide (PubChem CID 138728417) has the molecular formula C15H31NO6S and a molecular weight of 353.48 g/mol. Its IUPAC name is N-[2-[2-[2-[2-(methylsulfanylmethoxy)ethoxy]ethoxy]ethoxy]ethyl]-2-propan-2-yloxyacetamide.
| Compound Name | N-[2-[2-[2-[2-(methylsulfanylmethoxy)ethoxy]ethoxy]ethoxy]ethyl]-2-propan-2-yloxyacetamide |
|---|---|
| PubChem CID | 138728417 |
| Molecular Formula | C15H31NO6S |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | N-[2-[2-[2-[2-(methylsulfanylmethoxy)ethoxy]ethoxy]ethoxy]ethyl]-2-propan-2-yloxyacetamide |
| SMILES | CSCOCCOCCOCCOCCNC(=O)COC(C)C |
| InChI | InChI=1S/C15H31NO6S/c1-14(2)22-12-15(17)16-4-5-18-6-7-19-8-9-20-10-11-21-13-23-3/h14H,4-13H2,1-3H3,(H,16,17) |
| InChIKey | XLXOAYXBRWXEQW-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|