C15H30N2O — CID 43596504
N-[3-(cyclopropylamino)propyl]-3,5,5-trimethylhexanamide (PubChem CID 43596504) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is N-[3-(cyclopropylamino)propyl]-3,5,5-trimethylhexanamide.
| Compound Name | N-[3-(cyclopropylamino)propyl]-3,5,5-trimethylhexanamide |
|---|---|
| PubChem CID | 43596504 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | N-[3-(cyclopropylamino)propyl]-3,5,5-trimethylhexanamide |
| SMILES | CC(CC(=O)NCCCNC1CC1)CC(C)(C)C |
| InChI | InChI=1S/C15H30N2O/c1-12(11-15(2,3)4)10-14(18)17-9-5-8-16-13-6-7-13/h12-13,16H,5-11H2,1-4H3,(H,17,18) |
| InChIKey | ZSBYXKXHGLIBBC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|