C17H23N3O7 — CID 143747948
(diacetylamino) 6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoate (PubChem CID 143747948) has the molecular formula C17H23N3O7 and a molecular weight of 381.39 g/mol. Its IUPAC name is (diacetylamino) 6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoate.
| Compound Name | (diacetylamino) 6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoate |
|---|---|
| PubChem CID | 143747948 |
| Molecular Formula | C17H23N3O7 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | (diacetylamino) 6-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoate |
| SMILES | CC(=O)N(OC(=O)CCCCCNC(=O)CCN1C(=O)C=CC1=O)C(C)=O |
| InChI | InChI=1S/C17H23N3O7/c1-12(21)20(13(2)22)27-17(26)6-4-3-5-10-18-14(23)9-11-19-15(24)7-8-16(19)25/h7-8H,3-6,9-11H2,1-2H3,(H,18,23) |
| InChIKey | UAORRHFPOROFSA-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|