C20H32N4O5 — CID 156842098
(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-N-[2-(ethylamino)-2-oxoethyl]-3-methylpentanamide (PubChem CID 156842098) has the molecular formula C20H32N4O5 and a molecular weight of 408.50 g/mol. Its IUPAC name is (2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-N-[2-(ethylamino)-2-oxoethyl]-3-methylpentanamide.
| Compound Name | (2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-N-[2-(ethylamino)-2-oxoethyl]-3-methylpentanamide |
|---|---|
| PubChem CID | 156842098 |
| Molecular Formula | C20H32N4O5 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | (2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-N-[2-(ethylamino)-2-oxoethyl]-3-methylpentanamide |
| SMILES | CCNC(=O)CNC(=O)[C@@H](NC(=O)CCCCCN1C(=O)C=CC1=O)C(C)CC |
| InChI | InChI=1S/C20H32N4O5/c1-4-14(3)19(20(29)22-13-16(26)21-5-2)23-15(25)9-7-6-8-12-24-17(27)10-11-18(24)28/h10-11,14,19H,4-9,12-13H2,1-3H3,(H,21,26)(H,22,29)(H,23,25)/t14?,19-/m0/s1 |
| InChIKey | VKHBGCWVIJRWQM-PKDNWHCCSA-N |
| XLogP | 0.25 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|