C10H16N6O4 — CID 23557818
2-[2-(2,5-dioxopyrrol-1-yl)ethyl-(2-hydrazinyl-2-oxoethyl)amino]acetohydrazide (PubChem CID 23557818) has the molecular formula C10H16N6O4 and a molecular weight of 284.28 g/mol. Its IUPAC name is 2-[2-(2,5-dioxopyrrol-1-yl)ethyl-(2-hydrazinyl-2-oxoethyl)amino]acetohydrazide.
| Compound Name | 2-[2-(2,5-dioxopyrrol-1-yl)ethyl-(2-hydrazinyl-2-oxoethyl)amino]acetohydrazide |
|---|---|
| PubChem CID | 23557818 |
| Molecular Formula | C10H16N6O4 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2-[2-(2,5-dioxopyrrol-1-yl)ethyl-(2-hydrazinyl-2-oxoethyl)amino]acetohydrazide |
| SMILES | NNC(=O)CN(CCN1C(=O)C=CC1=O)CC(=O)NN |
| InChI | InChI=1S/C10H16N6O4/c11-13-7(17)5-15(6-8(18)14-12)3-4-16-9(19)1-2-10(16)20/h1-2H,3-6,11-12H2,(H,13,17)(H,14,18) |
| InChIKey | RZEDTJVBKIPRPV-UHFFFAOYSA-N |
| XLogP | -3.81 |
| TPSA | 150.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | -3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|