C21H33N5O11 — CID 146322844
2-[2-[bis(carboxymethyl)amino]ethyl-[2-[2,2-dihydroxyethyl-[2-[3-(2,5-dioxopyrrol-1-yl)propylamino]-2-oxoethyl]amino]ethyl]amino]acetic acid (PubChem CID 146322844) has the molecular formula C21H33N5O11 and a molecular weight of 531.52 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[2,2-dihydroxyethyl-[2-[3-(2,5-dioxopyrrol-1-yl)propylamino]-2-oxoethyl]amino]ethyl]amino]acetic acid.
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[2,2-dihydroxyethyl-[2-[3-(2,5-dioxopyrrol-1-yl)propylamino]-2-oxoethyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 146322844 |
| Molecular Formula | C21H33N5O11 |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[2,2-dihydroxyethyl-[2-[3-(2,5-dioxopyrrol-1-yl)propylamino]-2-oxoethyl]amino]ethyl]amino]acetic acid |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CCN(CC(=O)NCCCN1C(=O)C=CC1=O)CC(O)O |
| InChI | InChI=1S/C21H33N5O11/c27-15(22-4-1-5-26-16(28)2-3-17(26)29)10-24(12-19(32)33)8-6-23(11-18(30)31)7-9-25(13-20(34)35)14-21(36)37/h2-3,19,32-33H,1,4-14H2,(H,22,27)(H,30,31)(H,34,35)(H,36,37) |
| InChIKey | UOQFKYDXZUANMI-UHFFFAOYSA-N |
| XLogP | -4.11 |
| TPSA | 228.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | -4.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|