C9H13NO4 — CID 59992624
1-[3-(2-hydroxyethoxy)propyl]pyrrole-2,5-dione (PubChem CID 59992624) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is 1-[3-(2-hydroxyethoxy)propyl]pyrrole-2,5-dione.
| Compound Name | 1-[3-(2-hydroxyethoxy)propyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 59992624 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 1-[3-(2-hydroxyethoxy)propyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CCCOCCO |
| InChI | InChI=1S/C9H13NO4/c11-5-7-14-6-1-4-10-8(12)2-3-9(10)13/h2-3,11H,1,4-7H2 |
| InChIKey | ACIWDRNHNGAFTK-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|