C19H29NO8 — CID 158949468
2-[2-[2-[9-(2,5-dioxopyrrol-1-yl)-4-oxononoxy]ethoxy]ethoxy]acetic acid (PubChem CID 158949468) has the molecular formula C19H29NO8 and a molecular weight of 399.44 g/mol. Its IUPAC name is 2-[2-[2-[9-(2,5-dioxopyrrol-1-yl)-4-oxononoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[9-(2,5-dioxopyrrol-1-yl)-4-oxononoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 158949468 |
| Molecular Formula | C19H29NO8 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 2-[2-[2-[9-(2,5-dioxopyrrol-1-yl)-4-oxononoxy]ethoxy]ethoxy]acetic acid |
| SMILES | O=C(O)COCCOCCOCCCC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C19H29NO8/c21-16(5-2-1-3-9-20-17(22)7-8-18(20)23)6-4-10-26-11-12-27-13-14-28-15-19(24)25/h7-8H,1-6,9-15H2,(H,24,25) |
| InChIKey | QHWOGOKUSCEONT-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|