C17H38N4O7P+ — CID 118588413
2-[2-[3-(6-aminohexanoylamino)propanoylamino]ethoxy]ethyl-dimethyl-(2-phosphonooxyethyl)azanium (PubChem CID 118588413) has the molecular formula C17H38N4O7P+ and a molecular weight of 441.49 g/mol. Its IUPAC name is 2-[2-[3-(6-aminohexanoylamino)propanoylamino]ethoxy]ethyl-dimethyl-(2-phosphonooxyethyl)azanium.
| Compound Name | 2-[2-[3-(6-aminohexanoylamino)propanoylamino]ethoxy]ethyl-dimethyl-(2-phosphonooxyethyl)azanium |
|---|---|
| PubChem CID | 118588413 |
| Molecular Formula | C17H38N4O7P+ |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | 2-[2-[3-(6-aminohexanoylamino)propanoylamino]ethoxy]ethyl-dimethyl-(2-phosphonooxyethyl)azanium |
| SMILES | C[N+](C)(CCOCCNC(=O)CCNC(=O)CCCCCN)CCOP(=O)(O)O |
| InChI | InChI=1S/C17H37N4O7P/c1-21(2,12-15-28-29(24,25)26)11-14-27-13-10-20-17(23)7-9-19-16(22)6-4-3-5-8-18/h3-15,18H2,1-2H3,(H3-,19,20,22,23,24,25,26)/p+1 |
| InChIKey | LQXFRYIEJXNLGM-UHFFFAOYSA-O |
| XLogP | -0.67 |
| TPSA | 160.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|