C15H34N3O5P — CID 118588417
2-[3-(6-aminohexanoylamino)propyl-diethylazaniumyl]ethyl hydrogen phosphate (PubChem CID 118588417) has the molecular formula C15H34N3O5P and a molecular weight of 367.43 g/mol. Its IUPAC name is 2-[3-(6-aminohexanoylamino)propyl-diethylazaniumyl]ethyl hydrogen phosphate.
| Compound Name | 2-[3-(6-aminohexanoylamino)propyl-diethylazaniumyl]ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 118588417 |
| Molecular Formula | C15H34N3O5P |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | 2-[3-(6-aminohexanoylamino)propyl-diethylazaniumyl]ethyl hydrogen phosphate |
| SMILES | CC[N+](CC)(CCCNC(=O)CCCCCN)CCOP(=O)([O-])O |
| InChI | InChI=1S/C15H34N3O5P/c1-3-18(4-2,13-14-23-24(20,21)22)12-8-11-17-15(19)9-6-5-7-10-16/h3-14,16H2,1-2H3,(H2-,17,19,20,21,22) |
| InChIKey | WLCGKYXUZLHKBH-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 124.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|