C15H29NO7S — CID 57182546
N-[2-[2-[2-[2-[2-(2-oxoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-3-sulfanylpropanamide (PubChem CID 57182546) has the molecular formula C15H29NO7S and a molecular weight of 367.46 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[2-(2-oxoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-3-sulfanylpropanamide.
| Compound Name | N-[2-[2-[2-[2-[2-(2-oxoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 57182546 |
| Molecular Formula | C15H29NO7S |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | N-[2-[2-[2-[2-[2-(2-oxoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-3-sulfanylpropanamide |
| SMILES | O=CCOCCOCCOCCOCCOCCNC(=O)CCS |
| InChI | InChI=1S/C15H29NO7S/c17-3-5-20-7-9-22-11-13-23-12-10-21-8-6-19-4-2-16-15(18)1-14-24/h3,24H,1-2,4-14H2,(H,16,18) |
| InChIKey | FSNNWRJDWNECAX-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|