C18H33N3O8 — CID 58699778
3-[[3-oxo-3-[2-[2-(2-oxo-2-tritioethoxy)ethoxy]ethylamino]propyl]amino]-N-[2-[2-(2-oxo-2-tritioethoxy)ethoxy]ethyl]propanamide (PubChem CID 58699778) has the molecular formula C18H33N3O8 and a molecular weight of 423.49 g/mol. Its IUPAC name is 3-[[3-oxo-3-[2-[2-(2-oxo-2-tritioethoxy)ethoxy]ethylamino]propyl]amino]-N-[2-[2-(2-oxo-2-tritioethoxy)ethoxy]ethyl]propanamide.
| Compound Name | 3-[[3-oxo-3-[2-[2-(2-oxo-2-tritioethoxy)ethoxy]ethylamino]propyl]amino]-N-[2-[2-(2-oxo-2-tritioethoxy)ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 58699778 |
| Molecular Formula | C18H33N3O8 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 3-[[3-oxo-3-[2-[2-(2-oxo-2-tritioethoxy)ethoxy]ethylamino]propyl]amino]-N-[2-[2-(2-oxo-2-tritioethoxy)ethoxy]ethyl]propanamide |
| SMILES | [3H]C(=O)COCCOCCNC(=O)CCNCCC(=O)NCCOCCOCC([3H])=O |
| InChI | InChI=1S/C18H33N3O8/c22-7-11-28-15-13-26-9-5-20-17(24)1-3-19-4-2-18(25)21-6-10-27-14-16-29-12-8-23/h7-8,19H,1-6,9-16H2,(H,20,24)(H,21,25)/i7T,8T |
| InChIKey | VNEJNWBRASMWEL-PTGCLLIWSA-N |
| XLogP | -1.95 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|