C20H41N3O3 — CID 126579186
N-[3-(tert-butylamino)-1-[2-(3,3-dimethylbutoxy)ethylamino]-1-oxopropan-2-yl]-2,2-dimethylpropanamide (PubChem CID 126579186) has the molecular formula C20H41N3O3 and a molecular weight of 371.57 g/mol. Its IUPAC name is N-[3-(tert-butylamino)-1-[2-(3,3-dimethylbutoxy)ethylamino]-1-oxopropan-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[3-(tert-butylamino)-1-[2-(3,3-dimethylbutoxy)ethylamino]-1-oxopropan-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 126579186 |
| Molecular Formula | C20H41N3O3 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.31 |
| IUPAC Name | N-[3-(tert-butylamino)-1-[2-(3,3-dimethylbutoxy)ethylamino]-1-oxopropan-2-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)CCOCCNC(=O)C(CNC(C)(C)C)NC(=O)C(C)(C)C |
| InChI | InChI=1S/C20H41N3O3/c1-18(2,3)10-12-26-13-11-21-16(24)15(14-22-20(7,8)9)23-17(25)19(4,5)6/h15,22H,10-14H2,1-9H3,(H,21,24)(H,23,25) |
| InChIKey | LOXBBFASGBUHAD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|