C15H31NO2 — CID 139317240
N-[4-(3,3-dimethylbutoxy)-2-methylbutan-2-yl]-2-methylpropanamide (PubChem CID 139317240) has the molecular formula C15H31NO2 and a molecular weight of 257.42 g/mol. Its IUPAC name is N-[4-(3,3-dimethylbutoxy)-2-methylbutan-2-yl]-2-methylpropanamide.
| Compound Name | N-[4-(3,3-dimethylbutoxy)-2-methylbutan-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 139317240 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | N-[4-(3,3-dimethylbutoxy)-2-methylbutan-2-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NC(C)(C)CCOCCC(C)(C)C |
| InChI | InChI=1S/C15H31NO2/c1-12(2)13(17)16-15(6,7)9-11-18-10-8-14(3,4)5/h12H,8-11H2,1-7H3,(H,16,17) |
| InChIKey | WHKJHDXTOBSXGW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|