C9H16INO3 — CID 101206393
methyl (2R)-3-iodo-2-methyl-2-(2-methylpropanoylamino)propanoate (PubChem CID 101206393) has the molecular formula C9H16INO3 and a molecular weight of 313.14 g/mol. Its IUPAC name is methyl (2R)-3-iodo-2-methyl-2-(2-methylpropanoylamino)propanoate.
| Compound Name | methyl (2R)-3-iodo-2-methyl-2-(2-methylpropanoylamino)propanoate |
|---|---|
| PubChem CID | 101206393 |
| Molecular Formula | C9H16INO3 |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | methyl (2R)-3-iodo-2-methyl-2-(2-methylpropanoylamino)propanoate |
| SMILES | COC(=O)[C@](C)(CI)NC(=O)C(C)C |
| InChI | InChI=1S/C9H16INO3/c1-6(2)7(12)11-9(3,5-10)8(13)14-4/h6H,5H2,1-4H3,(H,11,12)/t9-/m0/s1 |
| InChIKey | KYBBXMCUYRFHLJ-VIFPVBQESA-N |
| XLogP | 1.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|