About 2-hydroxyethyl N-pent-3-ynylcarbamate
2-hydroxyethyl N-pent-3-ynylcarbamate (PubChem CID 116645461) has the molecular formula C8H13NO3
and a molecular weight of 171.20 g/mol. Its IUPAC name is 2-hydroxyethyl N-pent-3-ynylcarbamate.
Molecular Properties
| Compound Name | 2-hydroxyethyl N-pent-3-ynylcarbamate |
| PubChem CID | 116645461 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 2-hydroxyethyl N-pent-3-ynylcarbamate |
| SMILES | CC#CCCNC(=O)OCCO |
| InChI | InChI=1S/C8H13NO3/c1-2-3-4-5-9-8(11)12-7-6-10/h10H,4-7H2,1H3,(H,9,11) |
| InChIKey | PGMCPEFLLZEDLL-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl N-pent-3-ynylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl N-pent-3-ynylcarbamate?
The IUPAC name of 2-hydroxyethyl N-pent-3-ynylcarbamate (CID 116645461) is 2-hydroxyethyl N-pent-3-ynylcarbamate.
What is the SMILES notation for 2-hydroxyethyl N-pent-3-ynylcarbamate?
The canonical SMILES for 2-hydroxyethyl N-pent-3-ynylcarbamate is CC#CCCNC(=O)OCCO.
What is the InChIKey of 2-hydroxyethyl N-pent-3-ynylcarbamate?
The InChIKey is PGMCPEFLLZEDLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3/c1-2-3-4-5-9-8(11)12-7-6-10/h10H,4-7H2,1H3,(H,9,11).
What are the key properties of 2-hydroxyethyl N-pent-3-ynylcarbamate?
2-hydroxyethyl N-pent-3-ynylcarbamate has a molecular weight of 171.20 g/mol, XLogP of 0.12, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl N-pent-3-ynylcarbamate is sourced from PubChem (CID 116645461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).