C17H28N2O7S — CID 159107716
methyl (5R)-5-[[(4S)-4-amino-5-ethoxy-5-oxopentanoyl]amino]-4-oxo-6-propanoylsulfanylhexanoate (PubChem CID 159107716) has the molecular formula C17H28N2O7S and a molecular weight of 404.49 g/mol. Its IUPAC name is methyl (5R)-5-[[(4S)-4-amino-5-ethoxy-5-oxopentanoyl]amino]-4-oxo-6-propanoylsulfanylhexanoate.
| Compound Name | methyl (5R)-5-[[(4S)-4-amino-5-ethoxy-5-oxopentanoyl]amino]-4-oxo-6-propanoylsulfanylhexanoate |
|---|---|
| PubChem CID | 159107716 |
| Molecular Formula | C17H28N2O7S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | methyl (5R)-5-[[(4S)-4-amino-5-ethoxy-5-oxopentanoyl]amino]-4-oxo-6-propanoylsulfanylhexanoate |
| SMILES | CCOC(=O)[C@@H](N)CCC(=O)N[C@@H](CSC(=O)CC)C(=O)CCC(=O)OC |
| InChI | InChI=1S/C17H28N2O7S/c1-4-16(23)27-10-12(13(20)7-9-15(22)25-3)19-14(21)8-6-11(18)17(24)26-5-2/h11-12H,4-10,18H2,1-3H3,(H,19,21)/t11-,12-/m0/s1 |
| InChIKey | YZAIAFVIZIBTEL-RYUDHWBXSA-N |
| XLogP | 0.33 |
| TPSA | 141.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|