C19H32BrN2O7S2- — CID 160823625
ethyl 5-[(4-amino-5-methoxy-5-oxopentanoyl)amino]-4-oxo-6-(2-oxopentyldisulfanyl)hexanoate bromide (PubChem CID 160823625) has the molecular formula C19H32BrN2O7S2- and a molecular weight of 544.51 g/mol. Its IUPAC name is ethyl 5-[(4-amino-5-methoxy-5-oxopentanoyl)amino]-4-oxo-6-(2-oxopentyldisulfanyl)hexanoate bromide.
| Compound Name | ethyl 5-[(4-amino-5-methoxy-5-oxopentanoyl)amino]-4-oxo-6-(2-oxopentyldisulfanyl)hexanoate bromide |
|---|---|
| PubChem CID | 160823625 |
| Molecular Formula | C19H32BrN2O7S2- |
| Molecular Weight | 544.51 g/mol |
| Exact Mass | 543.08 |
| IUPAC Name | ethyl 5-[(4-amino-5-methoxy-5-oxopentanoyl)amino]-4-oxo-6-(2-oxopentyldisulfanyl)hexanoate bromide |
| SMILES | CCCC(=O)CSSCC(NC(=O)CCC(N)C(=O)OC)C(=O)CCC(=O)OCC.[Br-] |
| InChI | InChI=1S/C19H32N2O7S2.BrH/c1-4-6-13(22)11-29-30-12-15(16(23)8-10-18(25)28-5-2)21-17(24)9-7-14(20)19(26)27-3;/h14-15H,4-12,20H2,1-3H3,(H,21,24);1H/p-1 |
| InChIKey | AFWGZXBRMXVIGJ-UHFFFAOYSA-M |
| XLogP | -1.58 |
| TPSA | 141.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.51 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|