About acetic acid;1-bromonon-2-yn-4-ol
acetic acid;1-bromonon-2-yn-4-ol (PubChem CID 71364762) has the molecular formula C11H19BrO3
and a molecular weight of 279.17 g/mol. Its IUPAC name is acetic acid;1-bromonon-2-yn-4-ol.
Molecular Properties
| Compound Name | acetic acid;1-bromonon-2-yn-4-ol |
| PubChem CID | 71364762 |
| Molecular Formula | C11H19BrO3 |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | acetic acid;1-bromonon-2-yn-4-ol |
| SMILES | CC(=O)O.CCCCCC(O)C#CCBr |
| InChI | InChI=1S/C9H15BrO.C2H4O2/c1-2-3-4-6-9(11)7-5-8-10;1-2(3)4/h9,11H,2-4,6,8H2,1H3;1H3,(H,3,4) |
| InChIKey | NAVMZMBMFVUDIS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;1-bromonon-2-yn-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;1-bromonon-2-yn-4-ol?
The IUPAC name of acetic acid;1-bromonon-2-yn-4-ol (CID 71364762) is acetic acid;1-bromonon-2-yn-4-ol.
What is the SMILES notation for acetic acid;1-bromonon-2-yn-4-ol?
The canonical SMILES for acetic acid;1-bromonon-2-yn-4-ol is CC(=O)O.CCCCCC(O)C#CCBr.
What is the InChIKey of acetic acid;1-bromonon-2-yn-4-ol?
The InChIKey is NAVMZMBMFVUDIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15BrO.C2H4O2/c1-2-3-4-6-9(11)7-5-8-10;1-2(3)4/h9,11H,2-4,6,8H2,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;1-bromonon-2-yn-4-ol?
acetic acid;1-bromonon-2-yn-4-ol has a molecular weight of 279.17 g/mol, XLogP of 2.42, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1-bromonon-2-yn-4-ol is sourced from PubChem (CID 71364762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).