C23H28NO7PS — CID 59776551
(2R)-3-(diethoxyphosphorylmethylsulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (PubChem CID 59776551) has the molecular formula C23H28NO7PS and a molecular weight of 493.52 g/mol. Its IUPAC name is (2R)-3-(diethoxyphosphorylmethylsulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid.
| Compound Name | (2R)-3-(diethoxyphosphorylmethylsulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 59776551 |
| Molecular Formula | C23H28NO7PS |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | (2R)-3-(diethoxyphosphorylmethylsulfanyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| SMILES | CCOP(=O)(CSC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)OCC |
| InChI | InChI=1S/C23H28NO7PS/c1-3-30-32(28,31-4-2)15-33-14-21(22(25)26)24-23(27)29-13-20-18-11-7-5-9-16(18)17-10-6-8-12-19(17)20/h5-12,20-21H,3-4,13-15H2,1-2H3,(H,24,27)(H,25,26)/t21-/m0/s1 |
| InChIKey | LVXGSRNOSKEQQL-NRFANRHFSA-N |
| XLogP | 4.94 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|