C23H27FNO7P — CID 102245092
(2S,4R)-4-diethoxyphosphoryl-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-fluorobutanoic acid (PubChem CID 102245092) has the molecular formula C23H27FNO7P and a molecular weight of 479.44 g/mol. Its IUPAC name is (2S,4R)-4-diethoxyphosphoryl-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-fluorobutanoic acid.
| Compound Name | (2S,4R)-4-diethoxyphosphoryl-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-fluorobutanoic acid |
|---|---|
| PubChem CID | 102245092 |
| Molecular Formula | C23H27FNO7P |
| Molecular Weight | 479.44 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | (2S,4R)-4-diethoxyphosphoryl-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-fluorobutanoic acid |
| SMILES | CCOP(=O)(OCC)[C@@H](F)C[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C23H27FNO7P/c1-3-31-33(29,32-4-2)21(24)13-20(22(26)27)25-23(28)30-14-19-17-11-7-5-9-15(17)16-10-6-8-12-18(16)19/h5-12,19-21H,3-4,13-14H2,1-2H3,(H,25,28)(H,26,27)/t20-,21+/m0/s1 |
| InChIKey | OHHGLABELVKAGU-LEWJYISDSA-N |
| XLogP | 4.93 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|