C18H18NO8P — CID 56845347
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phosphonooxypropanoic acid (PubChem CID 56845347) has the molecular formula C18H18NO8P and a molecular weight of 407.32 g/mol. Its IUPAC name is (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phosphonooxypropanoic acid.
| Compound Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phosphonooxypropanoic acid |
|---|---|
| PubChem CID | 56845347 |
| Molecular Formula | C18H18NO8P |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phosphonooxypropanoic acid |
| SMILES | O=C(N[C@H](COP(=O)(O)O)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C18H18NO8P/c20-17(21)16(10-27-28(23,24)25)19-18(22)26-9-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-16H,9-10H2,(H,19,22)(H,20,21)(H2,23,24,25)/t16-/m1/s1 |
| InChIKey | LGDJNCRIHRFKML-MRXNPFEDSA-N |
| XLogP | 2.09 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|