C25H25NO6P+ — CID 102270813
[(2S)-2-carboxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]-phenylmethoxyphosphanium (PubChem CID 102270813) has the molecular formula C25H25NO6P+ and a molecular weight of 466.45 g/mol. Its IUPAC name is [(2S)-2-carboxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]-phenylmethoxyphosphanium.
| Compound Name | [(2S)-2-carboxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]-phenylmethoxyphosphanium |
|---|---|
| PubChem CID | 102270813 |
| Molecular Formula | C25H25NO6P+ |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | [(2S)-2-carboxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]-phenylmethoxyphosphanium |
| SMILES | O=C(N[C@@H](CO[PH2+]OCc1ccccc1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H24NO6P/c27-24(28)23(16-32-33-31-14-17-8-2-1-3-9-17)26-25(29)30-15-22-20-12-6-4-10-18(20)19-11-5-7-13-21(19)22/h1-13,22-23H,14-16,33H2,(H-,26,27,28,29)/p+1/t23-/m0/s1 |
| InChIKey | JBUDTXJKAMZKMP-QHCPKHFHSA-O |
| XLogP | 4.45 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|