C10H23N2O4PS — CID 10637809
(2S)-6-amino-2-(diethoxyphosphinothioylamino)hexanoic acid (PubChem CID 10637809) has the molecular formula C10H23N2O4PS and a molecular weight of 298.35 g/mol. Its IUPAC name is (2S)-6-amino-2-(diethoxyphosphinothioylamino)hexanoic acid.
| Compound Name | (2S)-6-amino-2-(diethoxyphosphinothioylamino)hexanoic acid |
|---|---|
| PubChem CID | 10637809 |
| Molecular Formula | C10H23N2O4PS |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | (2S)-6-amino-2-(diethoxyphosphinothioylamino)hexanoic acid |
| SMILES | CCOP(=S)(N[C@@H](CCCCN)C(=O)O)OCC |
| InChI | InChI=1S/C10H23N2O4PS/c1-3-15-17(18,16-4-2)12-9(10(13)14)7-5-6-8-11/h9H,3-8,11H2,1-2H3,(H,12,18)(H,13,14)/t9-/m0/s1 |
| InChIKey | UHLSJRNYVJGTCV-VIFPVBQESA-N |
| XLogP | 1.46 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|