C10H16N2O5S — CID 102494757
(2S)-2-amino-5-[[(S)-carboxy-[(E)-prop-1-enyl]sulfanylmethyl]amino]-5-oxopentanoic acid (PubChem CID 102494757) has the molecular formula C10H16N2O5S and a molecular weight of 276.31 g/mol. Its IUPAC name is (2S)-2-amino-5-[[(S)-carboxy-[(E)-prop-1-enyl]sulfanylmethyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-[[(S)-carboxy-[(E)-prop-1-enyl]sulfanylmethyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 102494757 |
| Molecular Formula | C10H16N2O5S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | (2S)-2-amino-5-[[(S)-carboxy-[(E)-prop-1-enyl]sulfanylmethyl]amino]-5-oxopentanoic acid |
| SMILES | C/C=C/S[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H16N2O5S/c1-2-5-18-8(10(16)17)12-7(13)4-3-6(11)9(14)15/h2,5-6,8H,3-4,11H2,1H3,(H,12,13)(H,14,15)(H,16,17)/b5-2+/t6-,8-/m0/s1 |
| InChIKey | IMDMJJAEVKFIJE-JXKNXFGGSA-N |
| XLogP | -0.03 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|