C13H21ClN2O5S2 — CID 130453319
5-[[3-[(2-amino-3-oxobutyl)disulfanyl]-1-chloro-1-oxopropan-2-yl]amino]-2-methyl-5-oxopentanoic acid (PubChem CID 130453319) has the molecular formula C13H21ClN2O5S2 and a molecular weight of 384.91 g/mol. Its IUPAC name is 5-[[3-[(2-amino-3-oxobutyl)disulfanyl]-1-chloro-1-oxopropan-2-yl]amino]-2-methyl-5-oxopentanoic acid.
| Compound Name | 5-[[3-[(2-amino-3-oxobutyl)disulfanyl]-1-chloro-1-oxopropan-2-yl]amino]-2-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 130453319 |
| Molecular Formula | C13H21ClN2O5S2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 5-[[3-[(2-amino-3-oxobutyl)disulfanyl]-1-chloro-1-oxopropan-2-yl]amino]-2-methyl-5-oxopentanoic acid |
| SMILES | CC(=O)C(N)CSSCC(NC(=O)CCC(C)C(=O)O)C(=O)Cl |
| InChI | InChI=1S/C13H21ClN2O5S2/c1-7(13(20)21)3-4-11(18)16-10(12(14)19)6-23-22-5-9(15)8(2)17/h7,9-10H,3-6,15H2,1-2H3,(H,16,18)(H,20,21) |
| InChIKey | YKHSUORRHMOUAN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|