C10H16N2O4 — CID 156904179
2,3-dihydroxy-N',2-bis(prop-2-enyl)butanediamide (PubChem CID 156904179) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is 2,3-dihydroxy-N',2-bis(prop-2-enyl)butanediamide.
| Compound Name | 2,3-dihydroxy-N',2-bis(prop-2-enyl)butanediamide |
|---|---|
| PubChem CID | 156904179 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 2,3-dihydroxy-N',2-bis(prop-2-enyl)butanediamide |
| SMILES | C=CCNC(=O)C(O)C(O)(CC=C)C(N)=O |
| InChI | InChI=1S/C10H16N2O4/c1-3-5-10(16,9(11)15)7(13)8(14)12-6-4-2/h3-4,7,13,16H,1-2,5-6H2,(H2,11,15)(H,12,14) |
| InChIKey | OLLRRHOWCXAHIY-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|