C7H12N2O4 — CID 140977246
2,3-dihydroxy-2-prop-2-enylbutanediamide (PubChem CID 140977246) has the molecular formula C7H12N2O4 and a molecular weight of 188.18 g/mol. Its IUPAC name is 2,3-dihydroxy-2-prop-2-enylbutanediamide.
| Compound Name | 2,3-dihydroxy-2-prop-2-enylbutanediamide |
|---|---|
| PubChem CID | 140977246 |
| Molecular Formula | C7H12N2O4 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 2,3-dihydroxy-2-prop-2-enylbutanediamide |
| SMILES | C=CCC(O)(C(N)=O)C(O)C(N)=O |
| InChI | InChI=1S/C7H12N2O4/c1-2-3-7(13,6(9)12)4(10)5(8)11/h2,4,10,13H,1,3H2,(H2,8,11)(H2,9,12) |
| InChIKey | RDUGICOZNYRVNX-UHFFFAOYSA-N |
| XLogP | -2.37 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|