C32H40N2O6 — CID 58957957
[(2R,3R)-3-(4-tert-butylbenzoyl)oxy-1,4-dioxo-1,4-bis(prop-2-enylamino)butan-2-yl] 4-tert-butylbenzoate (PubChem CID 58957957) has the molecular formula C32H40N2O6 and a molecular weight of 548.68 g/mol. Its IUPAC name is [(2R,3R)-3-(4-tert-butylbenzoyl)oxy-1,4-dioxo-1,4-bis(prop-2-enylamino)butan-2-yl] 4-tert-butylbenzoate.
| Compound Name | [(2R,3R)-3-(4-tert-butylbenzoyl)oxy-1,4-dioxo-1,4-bis(prop-2-enylamino)butan-2-yl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 58957957 |
| Molecular Formula | C32H40N2O6 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.29 |
| IUPAC Name | [(2R,3R)-3-(4-tert-butylbenzoyl)oxy-1,4-dioxo-1,4-bis(prop-2-enylamino)butan-2-yl] 4-tert-butylbenzoate |
| SMILES | C=CCNC(=O)[C@H](OC(=O)c1ccc(C(C)(C)C)cc1)[C@@H](OC(=O)c1ccc(C(C)(C)C)cc1)C(=O)NCC=C |
| InChI | InChI=1S/C32H40N2O6/c1-9-19-33-27(35)25(39-29(37)21-11-15-23(16-12-21)31(3,4)5)26(28(36)34-20-10-2)40-30(38)22-13-17-24(18-14-22)32(6,7)8/h9-18,25-26H,1-2,19-20H2,3-8H3,(H,33,35)(H,34,36)/t25-,26-/m1/s1 |
| InChIKey | GCEPSNAJKGQLFQ-CLJLJLNGSA-N |
| XLogP | 4.64 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|