About [amino(phenyl)methyl] sulfite
[amino(phenyl)methyl] sulfite (PubChem CID 174667651) has the molecular formula C7H8NO3S-
and a molecular weight of 186.21 g/mol. Its IUPAC name is [amino(phenyl)methyl] sulfite.
Molecular Properties
| Compound Name | [amino(phenyl)methyl] sulfite |
| PubChem CID | 174667651 |
| Molecular Formula | C7H8NO3S- |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.02 |
| IUPAC Name | [amino(phenyl)methyl] sulfite |
| SMILES | NC(OS(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C7H9NO3S/c8-7(11-12(9)10)6-4-2-1-3-5-6/h1-5,7H,8H2,(H,9,10)/p-1 |
| InChIKey | VFDVIWFPQYKYKI-UHFFFAOYSA-M |
| XLogP | 0.45 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze [amino(phenyl)methyl] sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [amino(phenyl)methyl] sulfite?
The IUPAC name of [amino(phenyl)methyl] sulfite (CID 174667651) is [amino(phenyl)methyl] sulfite.
What is the SMILES notation for [amino(phenyl)methyl] sulfite?
The canonical SMILES for [amino(phenyl)methyl] sulfite is NC(OS(=O)[O-])c1ccccc1.
What is the InChIKey of [amino(phenyl)methyl] sulfite?
The InChIKey is VFDVIWFPQYKYKI-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H9NO3S/c8-7(11-12(9)10)6-4-2-1-3-5-6/h1-5,7H,8H2,(H,9,10)/p-1.
What are the key properties of [amino(phenyl)methyl] sulfite?
[amino(phenyl)methyl] sulfite has a molecular weight of 186.21 g/mol, XLogP of 0.45, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [amino(phenyl)methyl] sulfite is sourced from PubChem (CID 174667651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).