About 2-phenylpropyl sulfite
2-phenylpropyl sulfite (PubChem CID 123803116) has the molecular formula C9H11O3S-
and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-phenylpropyl sulfite.
Molecular Properties
| Compound Name | 2-phenylpropyl sulfite |
| PubChem CID | 123803116 |
| Molecular Formula | C9H11O3S- |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | 2-phenylpropyl sulfite |
| SMILES | CC(COS(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C9H12O3S/c1-8(7-12-13(10)11)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,10,11)/p-1 |
| InChIKey | UIHZJGHLGOJNEQ-UHFFFAOYSA-M |
| XLogP | 1.60 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylpropyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylpropyl sulfite?
The IUPAC name of 2-phenylpropyl sulfite (CID 123803116) is 2-phenylpropyl sulfite.
What is the SMILES notation for 2-phenylpropyl sulfite?
The canonical SMILES for 2-phenylpropyl sulfite is CC(COS(=O)[O-])c1ccccc1.
What is the InChIKey of 2-phenylpropyl sulfite?
The InChIKey is UIHZJGHLGOJNEQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H12O3S/c1-8(7-12-13(10)11)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,10,11)/p-1.
What are the key properties of 2-phenylpropyl sulfite?
2-phenylpropyl sulfite has a molecular weight of 199.25 g/mol, XLogP of 1.60, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylpropyl sulfite is sourced from PubChem (CID 123803116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).