C17H20F2O — CID 145463800
1,3-difluoro-2-(2-phenylpropoxy)benzene;ethane (PubChem CID 145463800) has the molecular formula C17H20F2O and a molecular weight of 278.34 g/mol. Its IUPAC name is 1,3-difluoro-2-(2-phenylpropoxy)benzene;ethane.
| Compound Name | 1,3-difluoro-2-(2-phenylpropoxy)benzene;ethane |
|---|---|
| PubChem CID | 145463800 |
| Molecular Formula | C17H20F2O |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 1,3-difluoro-2-(2-phenylpropoxy)benzene;ethane |
| SMILES | CC.CC(COc1c(F)cccc1F)c1ccccc1 |
| InChI | InChI=1S/C15H14F2O.C2H6/c1-11(12-6-3-2-4-7-12)10-18-15-13(16)8-5-9-14(15)17;1-2/h2-9,11H,10H2,1H3;1-2H3 |
| InChIKey | JXZNJNPZMNAFSM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |