C17H22F2O — CID 145463781
1,2-difluoro-3-(2-phenylpropoxy)cyclohexa-1,3-diene;ethane (PubChem CID 145463781) has the molecular formula C17H22F2O and a molecular weight of 280.36 g/mol. Its IUPAC name is 1,2-difluoro-3-(2-phenylpropoxy)cyclohexa-1,3-diene;ethane.
| Compound Name | 1,2-difluoro-3-(2-phenylpropoxy)cyclohexa-1,3-diene;ethane |
|---|---|
| PubChem CID | 145463781 |
| Molecular Formula | C17H22F2O |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 1,2-difluoro-3-(2-phenylpropoxy)cyclohexa-1,3-diene;ethane |
| SMILES | CC.CC(COC1=CCCC(F)=C1F)c1ccccc1 |
| InChI | InChI=1S/C15H16F2O.C2H6/c1-11(12-6-3-2-4-7-12)10-18-14-9-5-8-13(16)15(14)17;1-2/h2-4,6-7,9,11H,5,8,10H2,1H3;1-2H3 |
| InChIKey | IBXMCLFVNRQHRC-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |