About 1,2-difluoro-3-(2-phenylpropoxy)cyclohexa-1,3-diene;ethane
1,2-difluoro-3-(2-phenylpropoxy)cyclohexa-1,3-diene;ethane (PubChem CID 145463781) has the molecular formula C17H22F2O
and a molecular weight of 280.36 g/mol. Its IUPAC name is 1,2-difluoro-3-(2-phenylpropoxy)cyclohexa-1,3-diene;ethane.
Molecular Properties
| Compound Name | 1,2-difluoro-3-(2-phenylpropoxy)cyclohexa-1,3-diene;ethane |
| PubChem CID | 145463781 |
| Molecular Formula | C17H22F2O |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 1,2-difluoro-3-(2-phenylpropoxy)cyclohexa-1,3-diene;ethane |
| SMILES | CC.CC(COC1=CCCC(F)=C1F)c1ccccc1 |
| InChI | InChI=1S/C15H16F2O.C2H6/c1-11(12-6-3-2-4-7-12)10-18-14-9-5-8-13(16)15(14)17;1-2/h2-4,6-7,9,11H,5,8,10H2,1H3;1-2H3 |
| InChIKey | IBXMCLFVNRQHRC-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2-difluoro-3-(2-phenylpropoxy)cyclohexa-1,3-diene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-difluoro-3-(2-phenylpropoxy)cyclohexa-1,3-diene;ethane?
The IUPAC name of 1,2-difluoro-3-(2-phenylpropoxy)cyclohexa-1,3-diene;ethane (CID 145463781) is 1,2-difluoro-3-(2-phenylpropoxy)cyclohexa-1,3-diene;ethane.
What is the SMILES notation for 1,2-difluoro-3-(2-phenylpropoxy)cyclohexa-1,3-diene;ethane?
The canonical SMILES for 1,2-difluoro-3-(2-phenylpropoxy)cyclohexa-1,3-diene;ethane is CC.CC(COC1=CCCC(F)=C1F)c1ccccc1.
What is the InChIKey of 1,2-difluoro-3-(2-phenylpropoxy)cyclohexa-1,3-diene;ethane?
The InChIKey is IBXMCLFVNRQHRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16F2O.C2H6/c1-11(12-6-3-2-4-7-12)10-18-14-9-5-8-13(16)15(14)17;1-2/h2-4,6-7,9,11H,5,8,10H2,1H3;1-2H3.
What are the key properties of 1,2-difluoro-3-(2-phenylpropoxy)cyclohexa-1,3-diene;ethane?
1,2-difluoro-3-(2-phenylpropoxy)cyclohexa-1,3-diene;ethane has a molecular weight of 280.36 g/mol, XLogP of 5.66, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-difluoro-3-(2-phenylpropoxy)cyclohexa-1,3-diene;ethane is sourced from PubChem (CID 145463781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).