C10H9O5S- — CID 57291588
(1,3-dioxo-1-phenylbutan-2-yl) sulfite (PubChem CID 57291588) has the molecular formula C10H9O5S- and a molecular weight of 241.24 g/mol. Its IUPAC name is (1,3-dioxo-1-phenylbutan-2-yl) sulfite.
| Compound Name | (1,3-dioxo-1-phenylbutan-2-yl) sulfite |
|---|---|
| PubChem CID | 57291588 |
| Molecular Formula | C10H9O5S- |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | (1,3-dioxo-1-phenylbutan-2-yl) sulfite |
| SMILES | CC(=O)C(OS(=O)[O-])C(=O)c1ccccc1 |
| InChI | InChI=1S/C10H10O5S/c1-7(11)10(15-16(13)14)9(12)8-5-3-2-4-6-8/h2-6,10H,1H3,(H,13,14)/p-1 |
| InChIKey | HXZJWYYJVBIUNK-UHFFFAOYSA-M |
| XLogP | 0.64 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|