(1,3-dioxo-1-phenylbutan-2-yl) sulfite

C10H9O5S- — CID 57291588

IUPAC(1,3-dioxo-1-phenylbutan-2-yl) sulfite
SMILESCC(=O)C(OS(=O)[O-])C(=O)c1ccccc1
InChIInChI=1S/C10H10O5S/c1-7(11)10(15-16(13)14)9(12)8-5-3-2-4-6-8/h2-6,10H,1H3,(H,13,14)/p-1
InChIKeyHXZJWYYJVBIUNK-UHFFFAOYSA-M
MW241.24 g/mol
LogP0.64
Rot. Bonds5

About (1,3-dioxo-1-phenylbutan-2-yl) sulfite

(1,3-dioxo-1-phenylbutan-2-yl) sulfite (PubChem CID 57291588) has the molecular formula C10H9O5S- and a molecular weight of 241.24 g/mol. Its IUPAC name is (1,3-dioxo-1-phenylbutan-2-yl) sulfite.

Molecular Properties

Compound Name(1,3-dioxo-1-phenylbutan-2-yl) sulfite
PubChem CID57291588
Molecular FormulaC10H9O5S-
Molecular Weight241.24 g/mol
Exact Mass241.02
IUPAC Name(1,3-dioxo-1-phenylbutan-2-yl) sulfite
SMILESCC(=O)C(OS(=O)[O-])C(=O)c1ccccc1
InChIInChI=1S/C10H10O5S/c1-7(11)10(15-16(13)14)9(12)8-5-3-2-4-6-8/h2-6,10H,1H3,(H,13,14)/p-1
InChIKeyHXZJWYYJVBIUNK-UHFFFAOYSA-M
XLogP0.64
TPSA83.50 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.24
LogP ≤ 50.64
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze (1,3-dioxo-1-phenylbutan-2-yl) sulfite with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1,3-dioxo-1-phenylbutan-2-yl) sulfite?
The IUPAC name of (1,3-dioxo-1-phenylbutan-2-yl) sulfite (CID 57291588) is (1,3-dioxo-1-phenylbutan-2-yl) sulfite.
What is the SMILES notation for (1,3-dioxo-1-phenylbutan-2-yl) sulfite?
The canonical SMILES for (1,3-dioxo-1-phenylbutan-2-yl) sulfite is CC(=O)C(OS(=O)[O-])C(=O)c1ccccc1.
What is the InChIKey of (1,3-dioxo-1-phenylbutan-2-yl) sulfite?
The InChIKey is HXZJWYYJVBIUNK-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H10O5S/c1-7(11)10(15-16(13)14)9(12)8-5-3-2-4-6-8/h2-6,10H,1H3,(H,13,14)/p-1.
What are the key properties of (1,3-dioxo-1-phenylbutan-2-yl) sulfite?
(1,3-dioxo-1-phenylbutan-2-yl) sulfite has a molecular weight of 241.24 g/mol, XLogP of 0.64, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dioxo-1-phenylbutan-2-yl) sulfite is sourced from PubChem (CID 57291588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).