C20H18O8 — CID 141186850
1-O-(1,3-dioxo-1,3-diphenylpropan-2-yl) 4-O-methyl 2,3-dihydroxybutanedioate (PubChem CID 141186850) has the molecular formula C20H18O8 and a molecular weight of 386.36 g/mol. Its IUPAC name is 1-O-(1,3-dioxo-1,3-diphenylpropan-2-yl) 4-O-methyl 2,3-dihydroxybutanedioate.
| Compound Name | 1-O-(1,3-dioxo-1,3-diphenylpropan-2-yl) 4-O-methyl 2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 141186850 |
| Molecular Formula | C20H18O8 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 1-O-(1,3-dioxo-1,3-diphenylpropan-2-yl) 4-O-methyl 2,3-dihydroxybutanedioate |
| SMILES | COC(=O)C(O)C(O)C(=O)OC(C(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H18O8/c1-27-19(25)16(23)17(24)20(26)28-18(14(21)12-8-4-2-5-9-12)15(22)13-10-6-3-7-11-13/h2-11,16-18,23-24H,1H3 |
| InChIKey | BYMRHCMBOZIZOV-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|