About N,N-diphenylaniline;oxadiazole;1H-pyrrole
N,N-diphenylaniline;oxadiazole;1H-pyrrole (PubChem CID 174890335) has the molecular formula C24H22N4O
and a molecular weight of 382.47 g/mol. Its IUPAC name is N,N-diphenylaniline;oxadiazole;1H-pyrrole.
Molecular Properties
| Compound Name | N,N-diphenylaniline;oxadiazole;1H-pyrrole |
| PubChem CID | 174890335 |
| Molecular Formula | C24H22N4O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | N,N-diphenylaniline;oxadiazole;1H-pyrrole |
| SMILES | c1cc[nH]c1.c1ccc(N(c2ccccc2)c2ccccc2)cc1.c1conn1 |
| InChI | InChI=1S/C18H15N.C4H5N.C2H2N2O/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-4-5-3-1;1-2-5-4-3-1/h1-15H;1-5H;1-2H |
| InChIKey | WTHSQRHOIGJMBG-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-diphenylaniline;oxadiazole;1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diphenylaniline;oxadiazole;1H-pyrrole?
The IUPAC name of N,N-diphenylaniline;oxadiazole;1H-pyrrole (CID 174890335) is N,N-diphenylaniline;oxadiazole;1H-pyrrole.
What is the SMILES notation for N,N-diphenylaniline;oxadiazole;1H-pyrrole?
The canonical SMILES for N,N-diphenylaniline;oxadiazole;1H-pyrrole is c1cc[nH]c1.c1ccc(N(c2ccccc2)c2ccccc2)cc1.c1conn1.
What is the InChIKey of N,N-diphenylaniline;oxadiazole;1H-pyrrole?
The InChIKey is WTHSQRHOIGJMBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N.C4H5N.C2H2N2O/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-4-5-3-1;1-2-5-4-3-1/h1-15H;1-5H;1-2H.
What are the key properties of N,N-diphenylaniline;oxadiazole;1H-pyrrole?
N,N-diphenylaniline;oxadiazole;1H-pyrrole has a molecular weight of 382.47 g/mol, XLogP of 6.24, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diphenylaniline;oxadiazole;1H-pyrrole is sourced from PubChem (CID 174890335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).