C20H19N3 — CID 161076953
N,N-diphenyl-1H-pyrrol-3-amine;1H-pyrrole (PubChem CID 161076953) has the molecular formula C20H19N3 and a molecular weight of 301.39 g/mol. Its IUPAC name is N,N-diphenyl-1H-pyrrol-3-amine;1H-pyrrole.
| Compound Name | N,N-diphenyl-1H-pyrrol-3-amine;1H-pyrrole |
|---|---|
| PubChem CID | 161076953 |
| Molecular Formula | C20H19N3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | N,N-diphenyl-1H-pyrrol-3-amine;1H-pyrrole |
| SMILES | c1cc[nH]c1.c1ccc(N(c2ccccc2)c2cc[nH]c2)cc1 |
| InChI | InChI=1S/C16H14N2.C4H5N/c1-3-7-14(8-4-1)18(16-11-12-17-13-16)15-9-5-2-6-10-15;1-2-4-5-3-1/h1-13,17H;1-5H |
| InChIKey | UFKFJAJBPGXHKL-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 34.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |