About oxadiazole;N-phenylacetamide
oxadiazole;N-phenylacetamide (PubChem CID 174471182) has the molecular formula C10H11N3O2
and a molecular weight of 205.22 g/mol. Its IUPAC name is oxadiazole;N-phenylacetamide.
Molecular Properties
| Compound Name | oxadiazole;N-phenylacetamide |
| PubChem CID | 174471182 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | oxadiazole;N-phenylacetamide |
| SMILES | CC(=O)Nc1ccccc1.c1conn1 |
| InChI | InChI=1S/C8H9NO.C2H2N2O/c1-7(10)9-8-5-3-2-4-6-8;1-2-5-4-3-1/h2-6H,1H3,(H,9,10);1-2H |
| InChIKey | MZQHWJRWRJPUDK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze oxadiazole;N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxadiazole;N-phenylacetamide?
The IUPAC name of oxadiazole;N-phenylacetamide (CID 174471182) is oxadiazole;N-phenylacetamide.
What is the SMILES notation for oxadiazole;N-phenylacetamide?
The canonical SMILES for oxadiazole;N-phenylacetamide is CC(=O)Nc1ccccc1.c1conn1.
What is the InChIKey of oxadiazole;N-phenylacetamide?
The InChIKey is MZQHWJRWRJPUDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.C2H2N2O/c1-7(10)9-8-5-3-2-4-6-8;1-2-5-4-3-1/h2-6H,1H3,(H,9,10);1-2H.
What are the key properties of oxadiazole;N-phenylacetamide?
oxadiazole;N-phenylacetamide has a molecular weight of 205.22 g/mol, XLogP of 1.71, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxadiazole;N-phenylacetamide is sourced from PubChem (CID 174471182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).