C15H16F6N2O2 — CID 158377078
bis(3-aminophenol);1,1,1,3,3,3-hexafluoropropane (PubChem CID 158377078) has the molecular formula C15H16F6N2O2 and a molecular weight of 370.29 g/mol. Its IUPAC name is bis(3-aminophenol);1,1,1,3,3,3-hexafluoropropane.
| Compound Name | bis(3-aminophenol);1,1,1,3,3,3-hexafluoropropane |
|---|---|
| PubChem CID | 158377078 |
| Molecular Formula | C15H16F6N2O2 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | bis(3-aminophenol);1,1,1,3,3,3-hexafluoropropane |
| SMILES | FC(F)(F)CC(F)(F)F.Nc1cccc(O)c1.Nc1cccc(O)c1 |
| InChI | InChI=1S/2C6H7NO.C3H2F6/c2*7-5-2-1-3-6(8)4-5;4-2(5,6)1-3(7,8)9/h2*1-4,8H,7H2;1H2 |
| InChIKey | GVIGWGPTIFTWSS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|